C21H21N3O6 — CID 98538883
(4Z,5S)-1-(2-hydroxyethyl)-4-[1-(4-methoxyanilino)ethylidene]-5-(4-nitrophenyl)pyrrolidine-2,3-dione (PubChem CID 98538883) has the molecular formula C21H21N3O6 and a molecular weight of 411.41 g/mol. Its IUPAC name is (4Z,5S)-1-(2-hydroxyethyl)-4-[1-(4-methoxyanilino)ethylidene]-5-(4-nitrophenyl)pyrrolidine-2,3-dione.
| Compound Name | (4Z,5S)-1-(2-hydroxyethyl)-4-[1-(4-methoxyanilino)ethylidene]-5-(4-nitrophenyl)pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 98538883 |
| Molecular Formula | C21H21N3O6 |
| Molecular Weight | 411.41 g/mol |
| Exact Mass | 411.14 |
| IUPAC Name | (4Z,5S)-1-(2-hydroxyethyl)-4-[1-(4-methoxyanilino)ethylidene]-5-(4-nitrophenyl)pyrrolidine-2,3-dione |
| SMILES | COc1ccc(N/C(C)=C2\C(=O)C(=O)N(CCO)[C@H]2c2ccc([N+](=O)[O-])cc2)cc1 |
| InChI | InChI=1S/C21H21N3O6/c1-13(22-15-5-9-17(30-2)10-6-15)18-19(23(11-12-25)21(27)20(18)26)14-3-7-16(8-4-14)24(28)29/h3-10,19,22,25H,11-12H2,1-2H3/b18-13-/t19-/m0/s1 |
| InChIKey | RGFGIKCGKNMGPN-LJLZWOEMSA-N |
| XLogP | 2.43 |
| TPSA | 122.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.41 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|