About (3S,4S)-N-benzyl-N,4-dimethylpyrrolidine-3-carboxamide
(3S,4S)-N-benzyl-N,4-dimethylpyrrolidine-3-carboxamide (PubChem CID 98541238) has the molecular formula C14H20N2O
and a molecular weight of 232.33 g/mol. Its IUPAC name is (3S,4S)-N-benzyl-N,4-dimethylpyrrolidine-3-carboxamide.
Molecular Properties
| Compound Name | (3S,4S)-N-benzyl-N,4-dimethylpyrrolidine-3-carboxamide |
| PubChem CID | 98541238 |
| Molecular Formula | C14H20N2O |
| Molecular Weight | 232.33 g/mol |
| Exact Mass | 232.16 |
| IUPAC Name | (3S,4S)-N-benzyl-N,4-dimethylpyrrolidine-3-carboxamide |
| SMILES | C[C@@H]1CNC[C@H]1C(=O)N(C)Cc1ccccc1 |
| InChI | InChI=1S/C14H20N2O/c1-11-8-15-9-13(11)14(17)16(2)10-12-6-4-3-5-7-12/h3-7,11,13,15H,8-10H2,1-2H3/t11-,13-/m1/s1 |
| InChIKey | KQWLEHZMHAHAAF-DGCLKSJQSA-N |
| XLogP | 1.50 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 232.33 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (3S,4S)-N-benzyl-N,4-dimethylpyrrolidine-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3S,4S)-N-benzyl-N,4-dimethylpyrrolidine-3-carboxamide?
The IUPAC name of (3S,4S)-N-benzyl-N,4-dimethylpyrrolidine-3-carboxamide (CID 98541238) is (3S,4S)-N-benzyl-N,4-dimethylpyrrolidine-3-carboxamide.
What is the SMILES notation for (3S,4S)-N-benzyl-N,4-dimethylpyrrolidine-3-carboxamide?
The canonical SMILES for (3S,4S)-N-benzyl-N,4-dimethylpyrrolidine-3-carboxamide is C[C@@H]1CNC[C@H]1C(=O)N(C)Cc1ccccc1.
What is the InChIKey of (3S,4S)-N-benzyl-N,4-dimethylpyrrolidine-3-carboxamide?
The InChIKey is KQWLEHZMHAHAAF-DGCLKSJQSA-N. The full InChI is InChI=1S/C14H20N2O/c1-11-8-15-9-13(11)14(17)16(2)10-12-6-4-3-5-7-12/h3-7,11,13,15H,8-10H2,1-2H3/t11-,13-/m1/s1.
What are the key properties of (3S,4S)-N-benzyl-N,4-dimethylpyrrolidine-3-carboxamide?
(3S,4S)-N-benzyl-N,4-dimethylpyrrolidine-3-carboxamide has a molecular weight of 232.33 g/mol, XLogP of 1.50, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (3S,4S)-N-benzyl-N,4-dimethylpyrrolidine-3-carboxamide is sourced from PubChem (CID 98541238), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).