About [(Z)-[(4R)-2,5-dioxo-4-phenylpyrrolidin-3-ylidene]amino]thiourea
[(Z)-[(4R)-2,5-dioxo-4-phenylpyrrolidin-3-ylidene]amino]thiourea (PubChem CID 98542255) has the molecular formula C11H10N4O2S
and a molecular weight of 262.29 g/mol. Its IUPAC name is [(Z)-[(4R)-2,5-dioxo-4-phenylpyrrolidin-3-ylidene]amino]thiourea.
Molecular Properties
| Compound Name | [(Z)-[(4R)-2,5-dioxo-4-phenylpyrrolidin-3-ylidene]amino]thiourea |
| PubChem CID | 98542255 |
| Molecular Formula | C11H10N4O2S |
| Molecular Weight | 262.29 g/mol |
| Exact Mass | 262.05 |
| IUPAC Name | [(Z)-[(4R)-2,5-dioxo-4-phenylpyrrolidin-3-ylidene]amino]thiourea |
| SMILES | NC(=S)N/N=C1\C(=O)NC(=O)[C@@H]1c1ccccc1 |
| InChI | InChI=1S/C11H10N4O2S/c12-11(18)15-14-8-7(9(16)13-10(8)17)6-4-2-1-3-5-6/h1-5,7H,(H3,12,15,18)(H,13,16,17)/b14-8-/t7-/m1/s1 |
| InChIKey | LGOSUCDNYGFMDD-GIJHHBAFSA-N |
| XLogP | -0.38 |
| TPSA | 96.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 262.29 |
| LogP ≤ 5 | -0.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze [(Z)-[(4R)-2,5-dioxo-4-phenylpyrrolidin-3-ylidene]amino]thiourea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(Z)-[(4R)-2,5-dioxo-4-phenylpyrrolidin-3-ylidene]amino]thiourea?
The IUPAC name of [(Z)-[(4R)-2,5-dioxo-4-phenylpyrrolidin-3-ylidene]amino]thiourea (CID 98542255) is [(Z)-[(4R)-2,5-dioxo-4-phenylpyrrolidin-3-ylidene]amino]thiourea.
What is the SMILES notation for [(Z)-[(4R)-2,5-dioxo-4-phenylpyrrolidin-3-ylidene]amino]thiourea?
The canonical SMILES for [(Z)-[(4R)-2,5-dioxo-4-phenylpyrrolidin-3-ylidene]amino]thiourea is NC(=S)N/N=C1\C(=O)NC(=O)[C@@H]1c1ccccc1.
What is the InChIKey of [(Z)-[(4R)-2,5-dioxo-4-phenylpyrrolidin-3-ylidene]amino]thiourea?
The InChIKey is LGOSUCDNYGFMDD-GIJHHBAFSA-N. The full InChI is InChI=1S/C11H10N4O2S/c12-11(18)15-14-8-7(9(16)13-10(8)17)6-4-2-1-3-5-6/h1-5,7H,(H3,12,15,18)(H,13,16,17)/b14-8-/t7-/m1/s1.
What are the key properties of [(Z)-[(4R)-2,5-dioxo-4-phenylpyrrolidin-3-ylidene]amino]thiourea?
[(Z)-[(4R)-2,5-dioxo-4-phenylpyrrolidin-3-ylidene]amino]thiourea has a molecular weight of 262.29 g/mol, XLogP of -0.38, 2 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [(Z)-[(4R)-2,5-dioxo-4-phenylpyrrolidin-3-ylidene]amino]thiourea is sourced from PubChem (CID 98542255), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).