C21H25ClN2O2 — CID 98543634
2-[2-[(1R,9aR)-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-yl]ethylamino]-3-chloronaphthalene-1,4-dione (PubChem CID 98543634) has the molecular formula C21H25ClN2O2 and a molecular weight of 372.90 g/mol. Its IUPAC name is 2-[2-[(1R,9aR)-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-yl]ethylamino]-3-chloronaphthalene-1,4-dione.
| Compound Name | 2-[2-[(1R,9aR)-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-yl]ethylamino]-3-chloronaphthalene-1,4-dione |
|---|---|
| PubChem CID | 98543634 |
| Molecular Formula | C21H25ClN2O2 |
| Molecular Weight | 372.90 g/mol |
| Exact Mass | 372.16 |
| IUPAC Name | 2-[2-[(1R,9aR)-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-yl]ethylamino]-3-chloronaphthalene-1,4-dione |
| SMILES | O=C1C(Cl)=C(NCC[C@H]2CCCN3CCCC[C@H]23)C(=O)c2ccccc21 |
| InChI | InChI=1S/C21H25ClN2O2/c22-18-19(21(26)16-8-2-1-7-15(16)20(18)25)23-11-10-14-6-5-13-24-12-4-3-9-17(14)24/h1-2,7-8,14,17,23H,3-6,9-13H2/t14-,17-/m1/s1 |
| InChIKey | KHKZPCAJCDWDIV-RHSMWYFYSA-N |
| XLogP | 3.76 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.90 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'} |
|---|