C21H24O5 — CID 98546133
(1R,4R,8R,9S)-1,7,7-trimethyl-4-phenacyl-2,6-dioxatricyclo[6.2.2.04,9]dodecane-3,5-dione (PubChem CID 98546133) has the molecular formula C21H24O5 and a molecular weight of 356.42 g/mol. Its IUPAC name is (1R,4R,8R,9S)-1,7,7-trimethyl-4-phenacyl-2,6-dioxatricyclo[6.2.2.04,9]dodecane-3,5-dione.
| Compound Name | (1R,4R,8R,9S)-1,7,7-trimethyl-4-phenacyl-2,6-dioxatricyclo[6.2.2.04,9]dodecane-3,5-dione |
|---|---|
| PubChem CID | 98546133 |
| Molecular Formula | C21H24O5 |
| Molecular Weight | 356.42 g/mol |
| Exact Mass | 356.16 |
| IUPAC Name | (1R,4R,8R,9S)-1,7,7-trimethyl-4-phenacyl-2,6-dioxatricyclo[6.2.2.04,9]dodecane-3,5-dione |
| SMILES | CC1(C)OC(=O)[C@@]2(CC(=O)c3ccccc3)C(=O)O[C@]3(C)CC[C@@H]1[C@@H]2C3 |
| InChI | InChI=1S/C21H24O5/c1-19(2)14-9-10-20(3)11-15(14)21(17(23)25-19,18(24)26-20)12-16(22)13-7-5-4-6-8-13/h4-8,14-15H,9-12H2,1-3H3/t14-,15+,20-,21+/m1/s1 |
| InChIKey | GKAZVABVIMWGEQ-CALQCPNCSA-N |
| XLogP | 3.31 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.42 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|