C13H9NO6 — CID 98548948
(1R,8R,9R,13S)-6-nitro-11,14-dioxatetracyclo[6.5.2.02,7.09,13]pentadeca-2(7),3,5-triene-10,12-dione (PubChem CID 98548948) has the molecular formula C13H9NO6 and a molecular weight of 275.22 g/mol. Its IUPAC name is (1R,8R,9R,13S)-6-nitro-11,14-dioxatetracyclo[6.5.2.02,7.09,13]pentadeca-2(7),3,5-triene-10,12-dione.
| Compound Name | (1R,8R,9R,13S)-6-nitro-11,14-dioxatetracyclo[6.5.2.02,7.09,13]pentadeca-2(7),3,5-triene-10,12-dione |
|---|---|
| PubChem CID | 98548948 |
| Molecular Formula | C13H9NO6 |
| Molecular Weight | 275.22 g/mol |
| Exact Mass | 275.04 |
| IUPAC Name | (1R,8R,9R,13S)-6-nitro-11,14-dioxatetracyclo[6.5.2.02,7.09,13]pentadeca-2(7),3,5-triene-10,12-dione |
| SMILES | O=C1OC(=O)[C@H]2[C@H]1[C@H]1CO[C@H]2c2cccc([N+](=O)[O-])c21 |
| InChI | InChI=1S/C13H9NO6/c15-12-9-6-4-19-11(10(9)13(16)20-12)5-2-1-3-7(8(5)6)14(17)18/h1-3,6,9-11H,4H2/t6-,9+,10-,11-/m0/s1 |
| InChIKey | AEKDKATZWIHCHJ-AOCCWBLSSA-N |
| XLogP | 1.08 |
| TPSA | 95.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.22 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|