C15H8Cl6N2O2 — CID 98549165
(1S,2R,6S,7S)-1,7,8,9,10,10-hexachloro-4-(6-methyl-2-pyridinyl)-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione (PubChem CID 98549165) has the molecular formula C15H8Cl6N2O2 and a molecular weight of 460.96 g/mol. Its IUPAC name is (1S,2R,6S,7S)-1,7,8,9,10,10-hexachloro-4-(6-methyl-2-pyridinyl)-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione.
| Compound Name | (1S,2R,6S,7S)-1,7,8,9,10,10-hexachloro-4-(6-methyl-2-pyridinyl)-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione |
|---|---|
| PubChem CID | 98549165 |
| Molecular Formula | C15H8Cl6N2O2 |
| Molecular Weight | 460.96 g/mol |
| Exact Mass | 457.87 |
| IUPAC Name | (1S,2R,6S,7S)-1,7,8,9,10,10-hexachloro-4-(6-methyl-2-pyridinyl)-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione |
| SMILES | Cc1cccc(N2C(=O)[C@@H]3[C@H](C2=O)[C@]2(Cl)C(Cl)=C(Cl)[C@]3(Cl)C2(Cl)Cl)n1 |
| InChI | InChI=1S/C15H8Cl6N2O2/c1-5-3-2-4-6(22-5)23-11(24)7-8(12(23)25)14(19)10(17)9(16)13(7,18)15(14,20)21/h2-4,7-8H,1H3/t7-,8+,13-,14-/m0/s1 |
| InChIKey | ONLGQNURMPRXNY-NVIQENEESA-N |
| XLogP | 4.34 |
| TPSA | 50.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.96 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|