C14H20O5 — CID 98550063
propan-2-yl (1R,2R,4R,5S,8R,9S,10S)-2,5-dihydroxy-11-oxatricyclo[6.2.1.04,9]undec-6-ene-10-carboxylate (PubChem CID 98550063) has the molecular formula C14H20O5 and a molecular weight of 268.31 g/mol. Its IUPAC name is propan-2-yl (1R,2R,4R,5S,8R,9S,10S)-2,5-dihydroxy-11-oxatricyclo[6.2.1.04,9]undec-6-ene-10-carboxylate.
| Compound Name | propan-2-yl (1R,2R,4R,5S,8R,9S,10S)-2,5-dihydroxy-11-oxatricyclo[6.2.1.04,9]undec-6-ene-10-carboxylate |
|---|---|
| PubChem CID | 98550063 |
| Molecular Formula | C14H20O5 |
| Molecular Weight | 268.31 g/mol |
| Exact Mass | 268.13 |
| IUPAC Name | propan-2-yl (1R,2R,4R,5S,8R,9S,10S)-2,5-dihydroxy-11-oxatricyclo[6.2.1.04,9]undec-6-ene-10-carboxylate |
| SMILES | CC(C)OC(=O)[C@@H]1[C@H]2O[C@@H]3C=C[C@H](O)[C@H](C[C@H]2O)[C@@H]13 |
| InChI | InChI=1S/C14H20O5/c1-6(2)18-14(17)12-11-7-5-9(16)13(12)19-10(11)4-3-8(7)15/h3-4,6-13,15-16H,5H2,1-2H3/t7-,8-,9+,10+,11+,12-,13-/m0/s1 |
| InChIKey | MKDLWWZQFRZOGY-AOWPIVLJSA-N |
| XLogP | 0.25 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.31 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|