C9H8Cl6O2 — CID 98550713
(1S,4S,5R,6R)-1,2,3,4,5,6-hexachloro-7,7-dimethoxybicyclo[2.2.1]hept-2-ene (PubChem CID 98550713) has the molecular formula C9H8Cl6O2 and a molecular weight of 360.88 g/mol. Its IUPAC name is (1S,4S,5R,6R)-1,2,3,4,5,6-hexachloro-7,7-dimethoxybicyclo[2.2.1]hept-2-ene.
| Compound Name | (1S,4S,5R,6R)-1,2,3,4,5,6-hexachloro-7,7-dimethoxybicyclo[2.2.1]hept-2-ene |
|---|---|
| PubChem CID | 98550713 |
| Molecular Formula | C9H8Cl6O2 |
| Molecular Weight | 360.88 g/mol |
| Exact Mass | 357.87 |
| IUPAC Name | (1S,4S,5R,6R)-1,2,3,4,5,6-hexachloro-7,7-dimethoxybicyclo[2.2.1]hept-2-ene |
| SMILES | COC1(OC)[C@@]2(Cl)C(Cl)=C(Cl)[C@@]1(Cl)[C@H](Cl)[C@H]2Cl |
| InChI | InChI=1S/C9H8Cl6O2/c1-16-9(17-2)7(14)3(10)4(11)8(9,15)6(13)5(7)12/h3-4H,1-2H3/t3-,4-,7+,8+/m1/s1 |
| InChIKey | HVDYUTDWJCDTJP-FLMVNYLGSA-N |
| XLogP | 3.86 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.88 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|