C17H16N4O2 — CID 98550911
[(E)-[(2R)-5-oxo-1,2-diphenylpyrrolidin-3-ylidene]amino]urea (PubChem CID 98550911) has the molecular formula C17H16N4O2 and a molecular weight of 308.34 g/mol. Its IUPAC name is [(E)-[(2R)-5-oxo-1,2-diphenylpyrrolidin-3-ylidene]amino]urea.
| Compound Name | [(E)-[(2R)-5-oxo-1,2-diphenylpyrrolidin-3-ylidene]amino]urea |
|---|---|
| PubChem CID | 98550911 |
| Molecular Formula | C17H16N4O2 |
| Molecular Weight | 308.34 g/mol |
| Exact Mass | 308.13 |
| IUPAC Name | [(E)-[(2R)-5-oxo-1,2-diphenylpyrrolidin-3-ylidene]amino]urea |
| SMILES | NC(=O)N/N=C1\CC(=O)N(c2ccccc2)[C@@H]1c1ccccc1 |
| InChI | InChI=1S/C17H16N4O2/c18-17(23)20-19-14-11-15(22)21(13-9-5-2-6-10-13)16(14)12-7-3-1-4-8-12/h1-10,16H,11H2,(H3,18,20,23)/b19-14+/t16-/m1/s1 |
| InChIKey | UKIAXNMTOLINJG-NISQSXRWSA-N |
| XLogP | 2.19 |
| TPSA | 87.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.34 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|