C22H18ClN3O3 — CID 98552457
(1R,11S,12R,16R)-11-(2-chlorobenzoyl)-14-ethyl-9,10,14-triazatetracyclo[8.6.0.02,7.012,16]hexadeca-2,4,6,8-tetraene-13,15-dione (PubChem CID 98552457) has the molecular formula C22H18ClN3O3 and a molecular weight of 407.86 g/mol. Its IUPAC name is (1R,11S,12R,16R)-11-(2-chlorobenzoyl)-14-ethyl-9,10,14-triazatetracyclo[8.6.0.02,7.012,16]hexadeca-2,4,6,8-tetraene-13,15-dione.
| Compound Name | (1R,11S,12R,16R)-11-(2-chlorobenzoyl)-14-ethyl-9,10,14-triazatetracyclo[8.6.0.02,7.012,16]hexadeca-2,4,6,8-tetraene-13,15-dione |
|---|---|
| PubChem CID | 98552457 |
| Molecular Formula | C22H18ClN3O3 |
| Molecular Weight | 407.86 g/mol |
| Exact Mass | 407.10 |
| IUPAC Name | (1R,11S,12R,16R)-11-(2-chlorobenzoyl)-14-ethyl-9,10,14-triazatetracyclo[8.6.0.02,7.012,16]hexadeca-2,4,6,8-tetraene-13,15-dione |
| SMILES | CCN1C(=O)[C@@H]2[C@@H](C1=O)[C@@H]1c3ccccc3C=NN1[C@@H]2C(=O)c1ccccc1Cl |
| InChI | InChI=1S/C22H18ClN3O3/c1-2-25-21(28)16-17(22(25)29)19(20(27)14-9-5-6-10-15(14)23)26-18(16)13-8-4-3-7-12(13)11-24-26/h3-11,16-19H,2H2,1H3/t16-,17-,18+,19+/m1/s1 |
| InChIKey | MWJBSBULFXAXKK-YRXWBPOGSA-N |
| XLogP | 2.92 |
| TPSA | 70.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.86 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|