About (E)-N-[[(2S)-oxiran-2-yl]methoxy]-2,3-dihydroinden-1-imine
(E)-N-[[(2S)-oxiran-2-yl]methoxy]-2,3-dihydroinden-1-imine (PubChem CID 98552746) has the molecular formula C12H13NO2
and a molecular weight of 203.24 g/mol. Its IUPAC name is (E)-N-[[(2S)-oxiran-2-yl]methoxy]-2,3-dihydroinden-1-imine.
Molecular Properties
| Compound Name | (E)-N-[[(2S)-oxiran-2-yl]methoxy]-2,3-dihydroinden-1-imine |
| PubChem CID | 98552746 |
| Molecular Formula | C12H13NO2 |
| Molecular Weight | 203.24 g/mol |
| Exact Mass | 203.09 |
| IUPAC Name | (E)-N-[[(2S)-oxiran-2-yl]methoxy]-2,3-dihydroinden-1-imine |
| SMILES | c1ccc2c(c1)CC/C2=N\OC[C@@H]1CO1 |
| InChI | InChI=1S/C12H13NO2/c1-2-4-11-9(3-1)5-6-12(11)13-15-8-10-7-14-10/h1-4,10H,5-8H2/b13-12+/t10-/m0/s1 |
| InChIKey | MPOHYJRZDMKDNL-ZFEMDRMUSA-N |
| XLogP | 1.75 |
| TPSA | 34.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 203.24 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze (E)-N-[[(2S)-oxiran-2-yl]methoxy]-2,3-dihydroinden-1-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-N-[[(2S)-oxiran-2-yl]methoxy]-2,3-dihydroinden-1-imine?
The IUPAC name of (E)-N-[[(2S)-oxiran-2-yl]methoxy]-2,3-dihydroinden-1-imine (CID 98552746) is (E)-N-[[(2S)-oxiran-2-yl]methoxy]-2,3-dihydroinden-1-imine.
What is the SMILES notation for (E)-N-[[(2S)-oxiran-2-yl]methoxy]-2,3-dihydroinden-1-imine?
The canonical SMILES for (E)-N-[[(2S)-oxiran-2-yl]methoxy]-2,3-dihydroinden-1-imine is c1ccc2c(c1)CC/C2=N\OC[C@@H]1CO1.
What is the InChIKey of (E)-N-[[(2S)-oxiran-2-yl]methoxy]-2,3-dihydroinden-1-imine?
The InChIKey is MPOHYJRZDMKDNL-ZFEMDRMUSA-N. The full InChI is InChI=1S/C12H13NO2/c1-2-4-11-9(3-1)5-6-12(11)13-15-8-10-7-14-10/h1-4,10H,5-8H2/b13-12+/t10-/m0/s1.
What are the key properties of (E)-N-[[(2S)-oxiran-2-yl]methoxy]-2,3-dihydroinden-1-imine?
(E)-N-[[(2S)-oxiran-2-yl]methoxy]-2,3-dihydroinden-1-imine has a molecular weight of 203.24 g/mol, XLogP of 1.75, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-N-[[(2S)-oxiran-2-yl]methoxy]-2,3-dihydroinden-1-imine is sourced from PubChem (CID 98552746), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).