C14H11N5O — CID 98553520
(1S,4S,5S)-4,9-dimethyl-3-oxo-2-azabicyclo[3.2.2]non-8-ene-6,6,7,7-tetracarbonitrile (PubChem CID 98553520) has the molecular formula C14H11N5O and a molecular weight of 265.28 g/mol. Its IUPAC name is (1S,4S,5S)-4,9-dimethyl-3-oxo-2-azabicyclo[3.2.2]non-8-ene-6,6,7,7-tetracarbonitrile.
| Compound Name | (1S,4S,5S)-4,9-dimethyl-3-oxo-2-azabicyclo[3.2.2]non-8-ene-6,6,7,7-tetracarbonitrile |
|---|---|
| PubChem CID | 98553520 |
| Molecular Formula | C14H11N5O |
| Molecular Weight | 265.28 g/mol |
| Exact Mass | 265.10 |
| IUPAC Name | (1S,4S,5S)-4,9-dimethyl-3-oxo-2-azabicyclo[3.2.2]non-8-ene-6,6,7,7-tetracarbonitrile |
| SMILES | CC1=C[C@@H]2NC(=O)[C@@H](C)[C@@H]1C(C#N)(C#N)C2(C#N)C#N |
| InChI | InChI=1S/C14H11N5O/c1-8-3-10-13(4-15,5-16)14(6-17,7-18)11(8)9(2)12(20)19-10/h3,9-11H,1-2H3,(H,19,20)/t9-,10-,11+/m0/s1 |
| InChIKey | MXFZSVGGCKFIHX-GARJFASQSA-N |
| XLogP | 0.76 |
| TPSA | 124.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.28 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyano_cyano_A(23)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|