C17H25NO4 — CID 98555144
cyclohexyl 3-[(3aR,7aS)-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]propanoate (PubChem CID 98555144) has the molecular formula C17H25NO4 and a molecular weight of 307.39 g/mol. Its IUPAC name is cyclohexyl 3-[(3aR,7aS)-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]propanoate.
| Compound Name | cyclohexyl 3-[(3aR,7aS)-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]propanoate |
|---|---|
| PubChem CID | 98555144 |
| Molecular Formula | C17H25NO4 |
| Molecular Weight | 307.39 g/mol |
| Exact Mass | 307.18 |
| IUPAC Name | cyclohexyl 3-[(3aR,7aS)-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]propanoate |
| SMILES | O=C(CCN1C(=O)[C@H]2CCCC[C@H]2C1=O)OC1CCCCC1 |
| InChI | InChI=1S/C17H25NO4/c19-15(22-12-6-2-1-3-7-12)10-11-18-16(20)13-8-4-5-9-14(13)17(18)21/h12-14H,1-11H2/t13-,14+ |
| InChIKey | VUFQQQFJZFBPMH-OKILXGFUSA-N |
| XLogP | 2.43 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.39 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|