C10H10I2 — CID 98555283
(1S,2R,3R,4S,5R,6S,7R,8S,9R,10S)-6,10-diiodopentacyclo[5.3.0.02,5.03,9.04,8]decane (PubChem CID 98555283) has the molecular formula C10H10I2 and a molecular weight of 384.00 g/mol. Its IUPAC name is (1S,2R,3R,4S,5R,6S,7R,8S,9R,10S)-6,10-diiodopentacyclo[5.3.0.02,5.03,9.04,8]decane.
| Compound Name | (1S,2R,3R,4S,5R,6S,7R,8S,9R,10S)-6,10-diiodopentacyclo[5.3.0.02,5.03,9.04,8]decane |
|---|---|
| PubChem CID | 98555283 |
| Molecular Formula | C10H10I2 |
| Molecular Weight | 384.00 g/mol |
| Exact Mass | 383.89 |
| IUPAC Name | (1S,2R,3R,4S,5R,6S,7R,8S,9R,10S)-6,10-diiodopentacyclo[5.3.0.02,5.03,9.04,8]decane |
| SMILES | I[C@@H]1[C@H]2[C@H]3[C@@H](I)[C@H]4[C@@H]2[C@H]2[C@@H]1[C@H]3[C@H]42 |
| InChI | InChI=1S/C10H10I2/c11-9-5-1-2-4(5)8-7(9)3(1)6(2)10(8)12/h1-10H/t1-,2+,3-,4+,5-,6-,7+,8-,9+,10+/m1/s1 |
| InChIKey | CTOZWVMTSCJSMU-HUNDITLASA-N |
| XLogP | 2.59 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.00 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|