C8H12Br2O2S — CID 98555363
(1S,2R,3R,6R)-2,3-dibromo-9λ6-thiabicyclo[4.2.1]nonane 9,9-dioxide (PubChem CID 98555363) has the molecular formula C8H12Br2O2S and a molecular weight of 332.06 g/mol. Its IUPAC name is (1S,2R,3R,6R)-2,3-dibromo-9λ6-thiabicyclo[4.2.1]nonane 9,9-dioxide.
| Compound Name | (1S,2R,3R,6R)-2,3-dibromo-9λ6-thiabicyclo[4.2.1]nonane 9,9-dioxide |
|---|---|
| PubChem CID | 98555363 |
| Molecular Formula | C8H12Br2O2S |
| Molecular Weight | 332.06 g/mol |
| Exact Mass | 329.89 |
| IUPAC Name | (1S,2R,3R,6R)-2,3-dibromo-9λ6-thiabicyclo[4.2.1]nonane 9,9-dioxide |
| SMILES | O=S1(=O)[C@H]2CC[C@@H](Br)[C@H](Br)[C@@H]1CC2 |
| InChI | InChI=1S/C8H12Br2O2S/c9-6-3-1-5-2-4-7(8(6)10)13(5,11)12/h5-8H,1-4H2/t5-,6+,7-,8-/m0/s1 |
| InChIKey | RFFHTJJMSBLMPU-YWIQKCBGSA-N |
| XLogP | 2.25 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.06 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|