C16H12Br2FN3O2 — CID 98556041
(1S,7S,8R,9S,10R,11R)-9,10-dibromo-8-fluoro-4-phenyl-2,4,6-triazatetracyclo[5.4.2.02,6.08,11]tridec-12-ene-3,5-dione (PubChem CID 98556041) has the molecular formula C16H12Br2FN3O2 and a molecular weight of 457.10 g/mol. Its IUPAC name is (1S,7S,8R,9S,10R,11R)-9,10-dibromo-8-fluoro-4-phenyl-2,4,6-triazatetracyclo[5.4.2.02,6.08,11]tridec-12-ene-3,5-dione.
| Compound Name | (1S,7S,8R,9S,10R,11R)-9,10-dibromo-8-fluoro-4-phenyl-2,4,6-triazatetracyclo[5.4.2.02,6.08,11]tridec-12-ene-3,5-dione |
|---|---|
| PubChem CID | 98556041 |
| Molecular Formula | C16H12Br2FN3O2 |
| Molecular Weight | 457.10 g/mol |
| Exact Mass | 454.93 |
| IUPAC Name | (1S,7S,8R,9S,10R,11R)-9,10-dibromo-8-fluoro-4-phenyl-2,4,6-triazatetracyclo[5.4.2.02,6.08,11]tridec-12-ene-3,5-dione |
| SMILES | O=c1n(-c2ccccc2)c(=O)n2n1[C@H]1C=C[C@H]2[C@H]2[C@@H](Br)[C@@H](Br)[C@@]21F |
| InChI | InChI=1S/C16H12Br2FN3O2/c17-12-11-9-6-7-10(16(11,19)13(12)18)22-15(24)20(14(23)21(9)22)8-4-2-1-3-5-8/h1-7,9-13H/t9-,10-,11-,12+,13+,16-/m0/s1 |
| InChIKey | RMFVTUNDEGJHAY-NTSRYIDTSA-N |
| XLogP | 2.33 |
| TPSA | 48.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.10 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|