C13H20O6S2 — CID 98556082
[(1S,2S,4S,5R,6S,7R)-7-(methylsulfonyloxymethyl)-6-tricyclo[3.2.2.02,4]non-8-enyl]methyl methanesulfonate (PubChem CID 98556082) has the molecular formula C13H20O6S2 and a molecular weight of 336.43 g/mol. Its IUPAC name is [(1S,2S,4S,5R,6S,7R)-7-(methylsulfonyloxymethyl)-6-tricyclo[3.2.2.02,4]non-8-enyl]methyl methanesulfonate.
| Compound Name | [(1S,2S,4S,5R,6S,7R)-7-(methylsulfonyloxymethyl)-6-tricyclo[3.2.2.02,4]non-8-enyl]methyl methanesulfonate |
|---|---|
| PubChem CID | 98556082 |
| Molecular Formula | C13H20O6S2 |
| Molecular Weight | 336.43 g/mol |
| Exact Mass | 336.07 |
| IUPAC Name | [(1S,2S,4S,5R,6S,7R)-7-(methylsulfonyloxymethyl)-6-tricyclo[3.2.2.02,4]non-8-enyl]methyl methanesulfonate |
| SMILES | CS(=O)(=O)OC[C@@H]1[C@H]2C=C[C@H]([C@H]3C[C@H]23)[C@@H]1COS(C)(=O)=O |
| InChI | InChI=1S/C13H20O6S2/c1-20(14,15)18-6-12-8-3-4-9(11-5-10(8)11)13(12)7-19-21(2,16)17/h3-4,8-13H,5-7H2,1-2H3/t8-,9+,10-,11-,12+,13-/m1/s1 |
| InChIKey | AANDNWOQWGVROB-QRNINRFLSA-N |
| XLogP | 0.62 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.43 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|