C14H12O4 — CID 98556533
(1S,4R,7R,8R,9R,10R)-pentacyclo[6.4.0.02,10.03,7.04,9]dodeca-5,11-diene-5,6-dicarboxylic acid (PubChem CID 98556533) has the molecular formula C14H12O4 and a molecular weight of 244.25 g/mol. Its IUPAC name is (1S,4R,7R,8R,9R,10R)-pentacyclo[6.4.0.02,10.03,7.04,9]dodeca-5,11-diene-5,6-dicarboxylic acid.
| Compound Name | (1S,4R,7R,8R,9R,10R)-pentacyclo[6.4.0.02,10.03,7.04,9]dodeca-5,11-diene-5,6-dicarboxylic acid |
|---|---|
| PubChem CID | 98556533 |
| Molecular Formula | C14H12O4 |
| Molecular Weight | 244.25 g/mol |
| Exact Mass | 244.07 |
| IUPAC Name | (1S,4R,7R,8R,9R,10R)-pentacyclo[6.4.0.02,10.03,7.04,9]dodeca-5,11-diene-5,6-dicarboxylic acid |
| SMILES | O=C(O)C1=C(C(=O)O)[C@H]2C3C4[C@H]5C=C[C@@H]4[C@@H]2[C@@H]5[C@@H]13 |
| InChI | InChI=1S/C14H12O4/c15-13(16)11-9-6-3-1-2-4-5(3)8(9)10(7(4)6)12(11)14(17)18/h1-10H,(H,15,16)(H,17,18)/t3-,4+,5?,6-,7-,8?,9-,10-/m1/s1 |
| InChIKey | MDCAASGMNMUCMY-XGIIRPGDSA-N |
| XLogP | 1.01 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.25 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|