C16H16O4 — CID 98557283
1-[(1S,4R,5R,7R,8R,11S,12R,14R)-10-acetyl-6,13-dioxaheptacyclo[7.5.0.02,11.03,8.04,10.05,7.012,14]tetradecan-9-yl]ethanone (PubChem CID 98557283) has the molecular formula C16H16O4 and a molecular weight of 272.30 g/mol. Its IUPAC name is 1-[(1S,4R,5R,7R,8R,11S,12R,14R)-10-acetyl-6,13-dioxaheptacyclo[7.5.0.02,11.03,8.04,10.05,7.012,14]tetradecan-9-yl]ethanone.
| Compound Name | 1-[(1S,4R,5R,7R,8R,11S,12R,14R)-10-acetyl-6,13-dioxaheptacyclo[7.5.0.02,11.03,8.04,10.05,7.012,14]tetradecan-9-yl]ethanone |
|---|---|
| PubChem CID | 98557283 |
| Molecular Formula | C16H16O4 |
| Molecular Weight | 272.30 g/mol |
| Exact Mass | 272.10 |
| IUPAC Name | 1-[(1S,4R,5R,7R,8R,11S,12R,14R)-10-acetyl-6,13-dioxaheptacyclo[7.5.0.02,11.03,8.04,10.05,7.012,14]tetradecan-9-yl]ethanone |
| SMILES | CC(=O)C12[C@@H]3C4C5[C@H]1[C@H]1O[C@@H]1[C@H]5C2(C(C)=O)[C@H]4[C@H]1O[C@@H]13 |
| InChI | InChI=1S/C16H16O4/c1-3(17)15-7-5-6-8(15)12-14(20-12)10(6)16(15,4(2)18)9(5)13-11(7)19-13/h5-14H,1-2H3/t5?,6?,7-,8+,9-,10+,11-,12-,13-,14-,15?,16?/m1/s1 |
| InChIKey | TYRMFXIMXWHQHA-FXVYAYPWSA-N |
| XLogP | 0.44 |
| TPSA | 59.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.30 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|