C16H18O2 — CID 98557310
(1R,2S,4R,5S,7R,8R,9S,12S,15R,16S)-heptacyclo[8.5.1.01,8.04,16.05,9.08,12.011,15]hexadec-13-ene-2,7-diol (PubChem CID 98557310) has the molecular formula C16H18O2 and a molecular weight of 242.32 g/mol. Its IUPAC name is (1R,2S,4R,5S,7R,8R,9S,12S,15R,16S)-heptacyclo[8.5.1.01,8.04,16.05,9.08,12.011,15]hexadec-13-ene-2,7-diol.
| Compound Name | (1R,2S,4R,5S,7R,8R,9S,12S,15R,16S)-heptacyclo[8.5.1.01,8.04,16.05,9.08,12.011,15]hexadec-13-ene-2,7-diol |
|---|---|
| PubChem CID | 98557310 |
| Molecular Formula | C16H18O2 |
| Molecular Weight | 242.32 g/mol |
| Exact Mass | 242.13 |
| IUPAC Name | (1R,2S,4R,5S,7R,8R,9S,12S,15R,16S)-heptacyclo[8.5.1.01,8.04,16.05,9.08,12.011,15]hexadec-13-ene-2,7-diol |
| SMILES | O[C@@H]1C[C@H]2[C@H]3C[C@H](O)[C@]45[C@@H]6C=C[C@H]7C6C([C@H]34)[C@H]2[C@]175 |
| InChI | InChI=1S/C16H18O2/c17-9-3-5-6-4-10(18)16-8-2-1-7-11(8)12(14(6)16)13(5)15(7,9)16/h1-2,5-14,17-18H,3-4H2/t5-,6+,7-,8+,9+,10-,11?,12?,13-,14-,15+,16+/m0/s1 |
| InChIKey | KCTVTMCORKVROT-JDZXLVGJSA-N |
| XLogP | 1.04 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.32 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|