C17H17N3O2 — CID 98557329
(1S,2S,8R,10S,11S,12S)-11,12-dimethyl-5-phenyl-3,5,7-triazapentacyclo[6.4.0.02,11.03,7.010,12]dodecane-4,6-dione (PubChem CID 98557329) has the molecular formula C17H17N3O2 and a molecular weight of 295.34 g/mol. Its IUPAC name is (1S,2S,8R,10S,11S,12S)-11,12-dimethyl-5-phenyl-3,5,7-triazapentacyclo[6.4.0.02,11.03,7.010,12]dodecane-4,6-dione.
| Compound Name | (1S,2S,8R,10S,11S,12S)-11,12-dimethyl-5-phenyl-3,5,7-triazapentacyclo[6.4.0.02,11.03,7.010,12]dodecane-4,6-dione |
|---|---|
| PubChem CID | 98557329 |
| Molecular Formula | C17H17N3O2 |
| Molecular Weight | 295.34 g/mol |
| Exact Mass | 295.13 |
| IUPAC Name | (1S,2S,8R,10S,11S,12S)-11,12-dimethyl-5-phenyl-3,5,7-triazapentacyclo[6.4.0.02,11.03,7.010,12]dodecane-4,6-dione |
| SMILES | C[C@@]12[C@H]3[C@H]4C[C@@H]1[C@]2(C)[C@H]3n1c(=O)n(-c2ccccc2)c(=O)n14 |
| InChI | InChI=1S/C17H17N3O2/c1-16-11-8-10-12(16)13(17(11,16)2)20-15(22)18(14(21)19(10)20)9-6-4-3-5-7-9/h3-7,10-13H,8H2,1-2H3/t10-,11+,12+,13+,16+,17-/m1/s1 |
| InChIKey | VVVRPJWAPAXQJQ-RMHJXYRFSA-N |
| XLogP | 1.57 |
| TPSA | 48.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.34 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |