C10H10Cl4 — CID 98557382
(1S,3S,5S,8S)-4,4,9,9-tetrachloro-1-methyltricyclo[6.1.0.03,5]non-6-ene (PubChem CID 98557382) has the molecular formula C10H10Cl4 and a molecular weight of 272.00 g/mol. Its IUPAC name is (1S,3S,5S,8S)-4,4,9,9-tetrachloro-1-methyltricyclo[6.1.0.03,5]non-6-ene.
| Compound Name | (1S,3S,5S,8S)-4,4,9,9-tetrachloro-1-methyltricyclo[6.1.0.03,5]non-6-ene |
|---|---|
| PubChem CID | 98557382 |
| Molecular Formula | C10H10Cl4 |
| Molecular Weight | 272.00 g/mol |
| Exact Mass | 269.95 |
| IUPAC Name | (1S,3S,5S,8S)-4,4,9,9-tetrachloro-1-methyltricyclo[6.1.0.03,5]non-6-ene |
| SMILES | C[C@]12C[C@H]3[C@H](C=C[C@@H]1C2(Cl)Cl)C3(Cl)Cl |
| InChI | InChI=1S/C10H10Cl4/c1-8-4-6-5(9(6,11)12)2-3-7(8)10(8,13)14/h2-3,5-7H,4H2,1H3/t5-,6-,7-,8-/m0/s1 |
| InChIKey | BIOGEJDBBKRXFH-XAMCCFCMSA-N |
| XLogP | 4.18 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.00 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|