C20H22N2 — CID 98557470
2-[(2R,3R,4R,6S,7R,9S,10R,11S,14S,16R)-9-(cyanomethyl)-4-hexacyclo[8.5.1.02,6.03,14.07,16.011,15]hexadec-12-enyl]acetonitrile (PubChem CID 98557470) has the molecular formula C20H22N2 and a molecular weight of 290.41 g/mol. Its IUPAC name is 2-[(2R,3R,4R,6S,7R,9S,10R,11S,14S,16R)-9-(cyanomethyl)-4-hexacyclo[8.5.1.02,6.03,14.07,16.011,15]hexadec-12-enyl]acetonitrile.
| Compound Name | 2-[(2R,3R,4R,6S,7R,9S,10R,11S,14S,16R)-9-(cyanomethyl)-4-hexacyclo[8.5.1.02,6.03,14.07,16.011,15]hexadec-12-enyl]acetonitrile |
|---|---|
| PubChem CID | 98557470 |
| Molecular Formula | C20H22N2 |
| Molecular Weight | 290.41 g/mol |
| Exact Mass | 290.18 |
| IUPAC Name | 2-[(2R,3R,4R,6S,7R,9S,10R,11S,14S,16R)-9-(cyanomethyl)-4-hexacyclo[8.5.1.02,6.03,14.07,16.011,15]hexadec-12-enyl]acetonitrile |
| SMILES | N#CC[C@@H]1C[C@@H]2[C@@H]3C[C@H](CC#N)[C@H]4[C@@H]3C3C5[C@@H](C=C[C@H]54)[C@@H]1[C@H]32 |
| InChI | InChI=1S/C20H22N2/c21-5-3-9-7-13-14-8-10(4-6-22)16-12-2-1-11-15(9)18(13)20(17(11)12)19(14)16/h1-2,9-20H,3-4,7-8H2/t9-,10+,11-,12-,13-,14+,15+,16+,17?,18+,19+,20?/m0/s1 |
| InChIKey | OGHCMZRVEOKIBU-UTLHISLISA-N |
| XLogP | 3.63 |
| TPSA | 47.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.41 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|