C10H10O2 — CID 98557506
(1S,2S,3R,4R,5R,6R,7S,8S,9R,10R)-hexacyclo[5.3.0.01,9.02,5.03,9.04,8]decane-6,10-diol (PubChem CID 98557506) has the molecular formula C10H10O2 and a molecular weight of 162.19 g/mol. Its IUPAC name is (1S,2S,3R,4R,5R,6R,7S,8S,9R,10R)-hexacyclo[5.3.0.01,9.02,5.03,9.04,8]decane-6,10-diol.
| Compound Name | (1S,2S,3R,4R,5R,6R,7S,8S,9R,10R)-hexacyclo[5.3.0.01,9.02,5.03,9.04,8]decane-6,10-diol |
|---|---|
| PubChem CID | 98557506 |
| Molecular Formula | C10H10O2 |
| Molecular Weight | 162.19 g/mol |
| Exact Mass | 162.07 |
| IUPAC Name | (1S,2S,3R,4R,5R,6R,7S,8S,9R,10R)-hexacyclo[5.3.0.01,9.02,5.03,9.04,8]decane-6,10-diol |
| SMILES | O[C@H]1C2[C@@H]3[C@@H]4[C@@H]1[C@@H]1[C@@H]4[C@@]34[C@@H](O)[C@]214 |
| InChI | InChI=1S/C10H10O2/c11-7-2-1-3-5(2)10-6(7)4(1)9(3,10)8(10)12/h1-8,11-12H/t1-,2-,3-,4+,5-,6?,7-,8-,9+,10-/m1/s1 |
| InChIKey | ZJDGXXZQWCKVNQ-DYJYIKFXSA-N |
| XLogP | -0.54 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 162.19 |
| LogP ≤ 5 | -0.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |