C11H16O — CID 98557846
(1R,2S,4R,5R,7S,9S)-8-methoxytetracyclo[7.1.0.02,4.05,7]decane (PubChem CID 98557846) has the molecular formula C11H16O and a molecular weight of 164.25 g/mol. Its IUPAC name is (1R,2S,4R,5R,7S,9S)-8-methoxytetracyclo[7.1.0.02,4.05,7]decane.
| Compound Name | (1R,2S,4R,5R,7S,9S)-8-methoxytetracyclo[7.1.0.02,4.05,7]decane |
|---|---|
| PubChem CID | 98557846 |
| Molecular Formula | C11H16O |
| Molecular Weight | 164.25 g/mol |
| Exact Mass | 164.12 |
| IUPAC Name | (1R,2S,4R,5R,7S,9S)-8-methoxytetracyclo[7.1.0.02,4.05,7]decane |
| SMILES | COC1[C@H]2C[C@@H]2[C@@H]2C[C@@H]2[C@H]2C[C@H]12 |
| InChI | InChI=1S/C11H16O/c1-12-11-9-3-7(9)5-2-6(5)8-4-10(8)11/h5-11H,2-4H2,1H3/t5-,6+,7-,8-,9+,10+,11?/m1/s1 |
| InChIKey | RZERIWZAQKEWNM-ZKLQKOBASA-N |
| XLogP | 1.92 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 164.25 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |