C20H26O2 — CID 98557877
(1R,2S,3R,4R,7S,9R,10R,11R,15S,16R,17R,18S,19S)-17-(hydroxymethyl)heptacyclo[8.8.1.02,9.03,7.04,18.011,15.016,19]nonadecan-8-one (PubChem CID 98557877) has the molecular formula C20H26O2 and a molecular weight of 298.43 g/mol. Its IUPAC name is (1R,2S,3R,4R,7S,9R,10R,11R,15S,16R,17R,18S,19S)-17-(hydroxymethyl)heptacyclo[8.8.1.02,9.03,7.04,18.011,15.016,19]nonadecan-8-one.
| Compound Name | (1R,2S,3R,4R,7S,9R,10R,11R,15S,16R,17R,18S,19S)-17-(hydroxymethyl)heptacyclo[8.8.1.02,9.03,7.04,18.011,15.016,19]nonadecan-8-one |
|---|---|
| PubChem CID | 98557877 |
| Molecular Formula | C20H26O2 |
| Molecular Weight | 298.43 g/mol |
| Exact Mass | 298.19 |
| IUPAC Name | (1R,2S,3R,4R,7S,9R,10R,11R,15S,16R,17R,18S,19S)-17-(hydroxymethyl)heptacyclo[8.8.1.02,9.03,7.04,18.011,15.016,19]nonadecan-8-one |
| SMILES | O=C1[C@H]2[C@H]3[C@H]4[C@H]([C@H]5CC[C@H]1[C@H]53)[C@H](CO)[C@@H]1[C@H]3CCC[C@H]3[C@@H]2[C@H]14 |
| InChI | InChI=1S/C20H26O2/c21-6-11-12-7-2-1-3-8(7)15-16(12)17-14(11)9-4-5-10-13(9)18(17)19(15)20(10)22/h7-19,21H,1-6H2/t7-,8+,9-,10-,11+,12-,13-,14+,15+,16-,17-,18+,19+/m0/s1 |
| InChIKey | WOESDCFKYMNVND-VJPYBEKKSA-N |
| XLogP | 2.60 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.43 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |