C11H17NO3 — CID 98558427
methyl (1S,3E)-3-hydroxyimino-1-prop-2-enylcyclohexane-1-carboxylate (PubChem CID 98558427) has the molecular formula C11H17NO3 and a molecular weight of 211.26 g/mol. Its IUPAC name is methyl (1S,3E)-3-hydroxyimino-1-prop-2-enylcyclohexane-1-carboxylate.
| Compound Name | methyl (1S,3E)-3-hydroxyimino-1-prop-2-enylcyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 98558427 |
| Molecular Formula | C11H17NO3 |
| Molecular Weight | 211.26 g/mol |
| Exact Mass | 211.12 |
| IUPAC Name | methyl (1S,3E)-3-hydroxyimino-1-prop-2-enylcyclohexane-1-carboxylate |
| SMILES | C=CC[C@@]1(C(=O)OC)CCC/C(=N\O)C1 |
| InChI | InChI=1S/C11H17NO3/c1-3-6-11(10(13)15-2)7-4-5-9(8-11)12-14/h3,14H,1,4-8H2,2H3/b12-9+/t11-/m1/s1 |
| InChIKey | YLWNKHDFCZWLNK-LWMMSDEHSA-N |
| XLogP | 2.13 |
| TPSA | 58.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.26 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|