C20H34O2 — CID 98561115
(1S,2R,3S,4S)-2-hept-6-enyl-1,7,7-trimethyl-3-prop-2-enylbicyclo[2.2.1]heptane-2,3-diol (PubChem CID 98561115) has the molecular formula C20H34O2 and a molecular weight of 306.49 g/mol. Its IUPAC name is (1S,2R,3S,4S)-2-hept-6-enyl-1,7,7-trimethyl-3-prop-2-enylbicyclo[2.2.1]heptane-2,3-diol.
| Compound Name | (1S,2R,3S,4S)-2-hept-6-enyl-1,7,7-trimethyl-3-prop-2-enylbicyclo[2.2.1]heptane-2,3-diol |
|---|---|
| PubChem CID | 98561115 |
| Molecular Formula | C20H34O2 |
| Molecular Weight | 306.49 g/mol |
| Exact Mass | 306.26 |
| IUPAC Name | (1S,2R,3S,4S)-2-hept-6-enyl-1,7,7-trimethyl-3-prop-2-enylbicyclo[2.2.1]heptane-2,3-diol |
| SMILES | C=CCCCCC[C@@]1(O)[C@@]2(C)CC[C@@H](C2(C)C)[C@@]1(O)CC=C |
| InChI | InChI=1S/C20H34O2/c1-6-8-9-10-11-14-20(22)18(5)15-12-16(17(18,3)4)19(20,21)13-7-2/h6-7,16,21-22H,1-2,8-15H2,3-5H3/t16-,18-,19-,20+/m0/s1 |
| InChIKey | WIQLIVFIKSRNHM-FRYIKTPZSA-N |
| XLogP | 4.62 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.49 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|