C8H14N8 — CID 98561244
N-[(E)-[(2Z)-2-(4,5-dihydro-1H-imidazol-2-ylhydrazinylidene)ethylidene]amino]-4,5-dihydro-1H-imidazol-2-amine (PubChem CID 98561244) has the molecular formula C8H14N8 and a molecular weight of 222.26 g/mol. Its IUPAC name is N-[(E)-[(2Z)-2-(4,5-dihydro-1H-imidazol-2-ylhydrazinylidene)ethylidene]amino]-4,5-dihydro-1H-imidazol-2-amine.
| Compound Name | N-[(E)-[(2Z)-2-(4,5-dihydro-1H-imidazol-2-ylhydrazinylidene)ethylidene]amino]-4,5-dihydro-1H-imidazol-2-amine |
|---|---|
| PubChem CID | 98561244 |
| Molecular Formula | C8H14N8 |
| Molecular Weight | 222.26 g/mol |
| Exact Mass | 222.13 |
| IUPAC Name | N-[(E)-[(2Z)-2-(4,5-dihydro-1H-imidazol-2-ylhydrazinylidene)ethylidene]amino]-4,5-dihydro-1H-imidazol-2-amine |
| SMILES | C(/C=N/NC1=NCCN1)=N/NC1=NCCN1 |
| InChI | InChI=1S/C8H14N8/c1-2-10-7(9-1)15-13-5-6-14-16-8-11-3-4-12-8/h5-6H,1-4H2,(H2,9,10,15)(H2,11,12,16)/b13-5-,14-6+ |
| InChIKey | SOPLPTZKLARLQW-FUJGBLOQSA-N |
| XLogP | -1.94 |
| TPSA | 97.56 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.26 |
| LogP ≤ 5 | -1.94 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|