C8H7Cl5 — CID 98565005
(1S,4S,5R)-1,2,3,4-tetrachloro-5-(chloromethyl)bicyclo[2.2.1]hept-2-ene (PubChem CID 98565005) has the molecular formula C8H7Cl5 and a molecular weight of 280.41 g/mol. Its IUPAC name is (1S,4S,5R)-1,2,3,4-tetrachloro-5-(chloromethyl)bicyclo[2.2.1]hept-2-ene.
| Compound Name | (1S,4S,5R)-1,2,3,4-tetrachloro-5-(chloromethyl)bicyclo[2.2.1]hept-2-ene |
|---|---|
| PubChem CID | 98565005 |
| Molecular Formula | C8H7Cl5 |
| Molecular Weight | 280.41 g/mol |
| Exact Mass | 277.90 |
| IUPAC Name | (1S,4S,5R)-1,2,3,4-tetrachloro-5-(chloromethyl)bicyclo[2.2.1]hept-2-ene |
| SMILES | ClC[C@H]1C[C@]2(Cl)C[C@@]1(Cl)C(Cl)=C2Cl |
| InChI | InChI=1S/C8H7Cl5/c9-2-4-1-7(12)3-8(4,13)6(11)5(7)10/h4H,1-3H2/t4-,7+,8+/m1/s1 |
| InChIKey | LWNVUYSWBCUYQZ-WDZBIPAOSA-N |
| XLogP | 4.29 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.41 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|