About 4-[(2R)-octan-2-yl]sulfonyloxybutyl (2R)-octane-2-sulfonate
4-[(2R)-octan-2-yl]sulfonyloxybutyl (2R)-octane-2-sulfonate (PubChem CID 98566307) has the molecular formula C20H42O6S2
and a molecular weight of 442.68 g/mol. Its IUPAC name is 4-[(2R)-octan-2-yl]sulfonyloxybutyl (2R)-octane-2-sulfonate.
Molecular Properties
| Compound Name | 4-[(2R)-octan-2-yl]sulfonyloxybutyl (2R)-octane-2-sulfonate |
| PubChem CID | 98566307 |
| Molecular Formula | C20H42O6S2 |
| Molecular Weight | 442.68 g/mol |
| Exact Mass | 442.24 |
| IUPAC Name | 4-[(2R)-octan-2-yl]sulfonyloxybutyl (2R)-octane-2-sulfonate |
| SMILES | CCCCCC[C@@H](C)S(=O)(=O)OCCCCOS(=O)(=O)[C@H](C)CCCCCC |
| InChI | InChI=1S/C20H42O6S2/c1-5-7-9-11-15-19(3)27(21,22)25-17-13-14-18-26-28(23,24)20(4)16-12-10-8-6-2/h19-20H,5-18H2,1-4H3/t19-,20-/m1/s1 |
| InChIKey | PWGDFQHQYGXQCY-WOJBJXKFSA-N |
| XLogP | 5.18 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 442.68 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze 4-[(2R)-octan-2-yl]sulfonyloxybutyl (2R)-octane-2-sulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(2R)-octan-2-yl]sulfonyloxybutyl (2R)-octane-2-sulfonate?
The IUPAC name of 4-[(2R)-octan-2-yl]sulfonyloxybutyl (2R)-octane-2-sulfonate (CID 98566307) is 4-[(2R)-octan-2-yl]sulfonyloxybutyl (2R)-octane-2-sulfonate.
What is the SMILES notation for 4-[(2R)-octan-2-yl]sulfonyloxybutyl (2R)-octane-2-sulfonate?
The canonical SMILES for 4-[(2R)-octan-2-yl]sulfonyloxybutyl (2R)-octane-2-sulfonate is CCCCCC[C@@H](C)S(=O)(=O)OCCCCOS(=O)(=O)[C@H](C)CCCCCC.
What is the InChIKey of 4-[(2R)-octan-2-yl]sulfonyloxybutyl (2R)-octane-2-sulfonate?
The InChIKey is PWGDFQHQYGXQCY-WOJBJXKFSA-N. The full InChI is InChI=1S/C20H42O6S2/c1-5-7-9-11-15-19(3)27(21,22)25-17-13-14-18-26-28(23,24)20(4)16-12-10-8-6-2/h19-20H,5-18H2,1-4H3/t19-,20-/m1/s1.
What are the key properties of 4-[(2R)-octan-2-yl]sulfonyloxybutyl (2R)-octane-2-sulfonate?
4-[(2R)-octan-2-yl]sulfonyloxybutyl (2R)-octane-2-sulfonate has a molecular weight of 442.68 g/mol, XLogP of 5.18, 19 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(2R)-octan-2-yl]sulfonyloxybutyl (2R)-octane-2-sulfonate is sourced from PubChem (CID 98566307), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).