C17H25N3 — CID 98567321
1-[[(1R,2S,4S)-2-bicyclo[2.2.1]hept-5-enyl]methyl]-4-(1-methylpyrazol-4-yl)piperidine (PubChem CID 98567321) has the molecular formula C17H25N3 and a molecular weight of 271.41 g/mol. Its IUPAC name is 1-[[(1R,2S,4S)-2-bicyclo[2.2.1]hept-5-enyl]methyl]-4-(1-methylpyrazol-4-yl)piperidine.
| Compound Name | 1-[[(1R,2S,4S)-2-bicyclo[2.2.1]hept-5-enyl]methyl]-4-(1-methylpyrazol-4-yl)piperidine |
|---|---|
| PubChem CID | 98567321 |
| Molecular Formula | C17H25N3 |
| Molecular Weight | 271.41 g/mol |
| Exact Mass | 271.20 |
| IUPAC Name | 1-[[(1R,2S,4S)-2-bicyclo[2.2.1]hept-5-enyl]methyl]-4-(1-methylpyrazol-4-yl)piperidine |
| SMILES | Cn1cc(C2CCN(C[C@H]3C[C@H]4C=C[C@H]3C4)CC2)cn1 |
| InChI | InChI=1S/C17H25N3/c1-19-11-17(10-18-19)14-4-6-20(7-5-14)12-16-9-13-2-3-15(16)8-13/h2-3,10-11,13-16H,4-9,12H2,1H3/t13-,15-,16+/m0/s1 |
| InChIKey | USHPFPXYGHVTJI-CWRNSKLLSA-N |
| XLogP | 2.81 |
| TPSA | 21.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.41 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|