C12H22O2 — CID 98572257
(2R,4S)-5,5-dimethyl-4-propan-2-yl-2-[(Z)-prop-1-enyl]-1,3-dioxane (PubChem CID 98572257) has the molecular formula C12H22O2 and a molecular weight of 198.31 g/mol. Its IUPAC name is (2R,4S)-5,5-dimethyl-4-propan-2-yl-2-[(Z)-prop-1-enyl]-1,3-dioxane.
| Compound Name | (2R,4S)-5,5-dimethyl-4-propan-2-yl-2-[(Z)-prop-1-enyl]-1,3-dioxane |
|---|---|
| PubChem CID | 98572257 |
| Molecular Formula | C12H22O2 |
| Molecular Weight | 198.31 g/mol |
| Exact Mass | 198.16 |
| IUPAC Name | (2R,4S)-5,5-dimethyl-4-propan-2-yl-2-[(Z)-prop-1-enyl]-1,3-dioxane |
| SMILES | C/C=C\[C@@H]1OCC(C)(C)[C@H](C(C)C)O1 |
| InChI | InChI=1S/C12H22O2/c1-6-7-10-13-8-12(4,5)11(14-10)9(2)3/h6-7,9-11H,8H2,1-5H3/b7-6-/t10-,11+/m1/s1 |
| InChIKey | XYVOPPDFTDZQRJ-UQRGBAIESA-N |
| XLogP | 2.99 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.31 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|