C18H31N5O2 — CID 98574717
(2S)-2-(3,5-dimethyl-1H-pyrazol-4-yl)-N-[2-(2-methylpropanoylamino)ethyl]azepane-1-carboxamide (PubChem CID 98574717) has the molecular formula C18H31N5O2 and a molecular weight of 349.48 g/mol. Its IUPAC name is (2S)-2-(3,5-dimethyl-1H-pyrazol-4-yl)-N-[2-(2-methylpropanoylamino)ethyl]azepane-1-carboxamide.
| Compound Name | (2S)-2-(3,5-dimethyl-1H-pyrazol-4-yl)-N-[2-(2-methylpropanoylamino)ethyl]azepane-1-carboxamide |
|---|---|
| PubChem CID | 98574717 |
| Molecular Formula | C18H31N5O2 |
| Molecular Weight | 349.48 g/mol |
| Exact Mass | 349.25 |
| IUPAC Name | (2S)-2-(3,5-dimethyl-1H-pyrazol-4-yl)-N-[2-(2-methylpropanoylamino)ethyl]azepane-1-carboxamide |
| SMILES | Cc1n[nH]c(C)c1[C@@H]1CCCCCN1C(=O)NCCNC(=O)C(C)C |
| InChI | InChI=1S/C18H31N5O2/c1-12(2)17(24)19-9-10-20-18(25)23-11-7-5-6-8-15(23)16-13(3)21-22-14(16)4/h12,15H,5-11H2,1-4H3,(H,19,24)(H,20,25)(H,21,22)/t15-/m0/s1 |
| InChIKey | RXFPLHPWQGTNAO-HNNXBMFYSA-N |
| XLogP | 2.43 |
| TPSA | 90.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.48 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|