C19H17FN4O2S — CID 985748
6-[(3,4-dimethoxyphenyl)methyl]-3-[(4-fluorophenyl)methyl]-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazole (PubChem CID 985748) has the molecular formula C19H17FN4O2S and a molecular weight of 384.44 g/mol. Its IUPAC name is 6-[(3,4-dimethoxyphenyl)methyl]-3-[(4-fluorophenyl)methyl]-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazole.
| Compound Name | 6-[(3,4-dimethoxyphenyl)methyl]-3-[(4-fluorophenyl)methyl]-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazole |
|---|---|
| PubChem CID | 985748 |
| Molecular Formula | C19H17FN4O2S |
| Molecular Weight | 384.44 g/mol |
| Exact Mass | 384.11 |
| IUPAC Name | 6-[(3,4-dimethoxyphenyl)methyl]-3-[(4-fluorophenyl)methyl]-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazole |
| SMILES | COc1ccc(Cc2nn3c(Cc4ccc(F)cc4)nnc3s2)cc1OC |
| InChI | InChI=1S/C19H17FN4O2S/c1-25-15-8-5-13(9-16(15)26-2)11-18-23-24-17(21-22-19(24)27-18)10-12-3-6-14(20)7-4-12/h3-9H,10-11H2,1-2H3 |
| InChIKey | ZINKHZBZSNJCKA-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 61.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.44 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |