C6H12O9S3 — CID 98575301
[(4R,5S)-5-(methylsulfonyloxymethyl)-2-oxo-1,3,2-dioxathiolan-4-yl]methyl methanesulfonate (PubChem CID 98575301) has the molecular formula C6H12O9S3 and a molecular weight of 324.35 g/mol. Its IUPAC name is [(4R,5S)-5-(methylsulfonyloxymethyl)-2-oxo-1,3,2-dioxathiolan-4-yl]methyl methanesulfonate.
| Compound Name | [(4R,5S)-5-(methylsulfonyloxymethyl)-2-oxo-1,3,2-dioxathiolan-4-yl]methyl methanesulfonate |
|---|---|
| PubChem CID | 98575301 |
| Molecular Formula | C6H12O9S3 |
| Molecular Weight | 324.35 g/mol |
| Exact Mass | 323.96 |
| IUPAC Name | [(4R,5S)-5-(methylsulfonyloxymethyl)-2-oxo-1,3,2-dioxathiolan-4-yl]methyl methanesulfonate |
| SMILES | CS(=O)(=O)OC[C@@H]1OS(=O)O[C@@H]1COS(C)(=O)=O |
| InChI | InChI=1S/C6H12O9S3/c1-17(8,9)12-3-5-6(15-16(7)14-5)4-13-18(2,10)11/h5-6H,3-4H2,1-2H3/t5-,6+,16? |
| InChIKey | NUIVNAIWDLKFPS-MSDIUINRSA-N |
| XLogP | -1.70 |
| TPSA | 122.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.35 |
| LogP ≤ 5 | -1.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|