C17H16FN3O2 — CID 98586288
cis-(1R,2S)-2-(3-fluorophenyl)-N'-(2-pyridin-2-ylacetyl)cyclopropane-1-carbohydrazide (PubChem CID 98586288) has the molecular formula C17H16FN3O2 and a molecular weight of 313.33 g/mol. Its IUPAC name is cis-(1R,2S)-2-(3-fluorophenyl)-N'-(2-pyridin-2-ylacetyl)cyclopropane-1-carbohydrazide.
| Compound Name | cis-(1R,2S)-2-(3-fluorophenyl)-N'-(2-pyridin-2-ylacetyl)cyclopropane-1-carbohydrazide |
|---|---|
| PubChem CID | 98586288 |
| Molecular Formula | C17H16FN3O2 |
| Molecular Weight | 313.33 g/mol |
| Exact Mass | 313.12 |
| IUPAC Name | cis-(1R,2S)-2-(3-fluorophenyl)-N'-(2-pyridin-2-ylacetyl)cyclopropane-1-carbohydrazide |
| SMILES | O=C(Cc1ccccn1)NNC(=O)[C@@H]1C[C@@H]1c1cccc(F)c1 |
| InChI | InChI=1S/C17H16FN3O2/c18-12-5-3-4-11(8-12)14-10-15(14)17(23)21-20-16(22)9-13-6-1-2-7-19-13/h1-8,14-15H,9-10H2,(H,20,22)(H,21,23)/t14-,15-/m1/s1 |
| InChIKey | UYAIGYXRDRNKCA-HUUCEWRRSA-N |
| XLogP | 1.71 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.33 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|