C20H28BrNO4 — CID 98588244
2-bromo-3,4,5-trimethoxy-N-[(1R,2S,4R)-1,3,3-trimethyl-2-bicyclo[2.2.1]heptanyl]benzamide (PubChem CID 98588244) has the molecular formula C20H28BrNO4 and a molecular weight of 426.35 g/mol. Its IUPAC name is 2-bromo-3,4,5-trimethoxy-N-[(1R,2S,4R)-1,3,3-trimethyl-2-bicyclo[2.2.1]heptanyl]benzamide.
| Compound Name | 2-bromo-3,4,5-trimethoxy-N-[(1R,2S,4R)-1,3,3-trimethyl-2-bicyclo[2.2.1]heptanyl]benzamide |
|---|---|
| PubChem CID | 98588244 |
| Molecular Formula | C20H28BrNO4 |
| Molecular Weight | 426.35 g/mol |
| Exact Mass | 425.12 |
| IUPAC Name | 2-bromo-3,4,5-trimethoxy-N-[(1R,2S,4R)-1,3,3-trimethyl-2-bicyclo[2.2.1]heptanyl]benzamide |
| SMILES | COc1cc(C(=O)N[C@@H]2C(C)(C)[C@@H]3CC[C@]2(C)C3)c(Br)c(OC)c1OC |
| InChI | InChI=1S/C20H28BrNO4/c1-19(2)11-7-8-20(3,10-11)18(19)22-17(23)12-9-13(24-4)15(25-5)16(26-6)14(12)21/h9,11,18H,7-8,10H2,1-6H3,(H,22,23)/t11-,18-,20-/m1/s1 |
| InChIKey | FKZQNFAWKLNSDW-ZUNHGIIWSA-N |
| XLogP | 4.42 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.35 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |