C26H32N4O3 — CID 98590980
[2-[[(1R)-1-[(1R,2S,4R)-2-bicyclo[2.2.1]heptanyl]ethyl]amino]-2-oxoethyl] 2-[[4-(dimethylamino)phenyl]diazenyl]benzoate (PubChem CID 98590980) has the molecular formula C26H32N4O3 and a molecular weight of 448.57 g/mol. Its IUPAC name is [2-[[(1R)-1-[(1R,2S,4R)-2-bicyclo[2.2.1]heptanyl]ethyl]amino]-2-oxoethyl] 2-[[4-(dimethylamino)phenyl]diazenyl]benzoate.
| Compound Name | [2-[[(1R)-1-[(1R,2S,4R)-2-bicyclo[2.2.1]heptanyl]ethyl]amino]-2-oxoethyl] 2-[[4-(dimethylamino)phenyl]diazenyl]benzoate |
|---|---|
| PubChem CID | 98590980 |
| Molecular Formula | C26H32N4O3 |
| Molecular Weight | 448.57 g/mol |
| Exact Mass | 448.25 |
| IUPAC Name | [2-[[(1R)-1-[(1R,2S,4R)-2-bicyclo[2.2.1]heptanyl]ethyl]amino]-2-oxoethyl] 2-[[4-(dimethylamino)phenyl]diazenyl]benzoate |
| SMILES | C[C@@H](NC(=O)COC(=O)c1ccccc1/N=N/c1ccc(N(C)C)cc1)[C@H]1C[C@@H]2CC[C@@H]1C2 |
| InChI | InChI=1S/C26H32N4O3/c1-17(23-15-18-8-9-19(23)14-18)27-25(31)16-33-26(32)22-6-4-5-7-24(22)29-28-20-10-12-21(13-11-20)30(2)3/h4-7,10-13,17-19,23H,8-9,14-16H2,1-3H3,(H,27,31)/b29-28+/t17-,18-,19-,23-/m1/s1 |
| InChIKey | ZUDWFZUHOPRPLS-ACXHEAHGSA-N |
| XLogP | 5.27 |
| TPSA | 83.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.57 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|