C33H33N3O6S — CID 98593868
[(2R)-1-(2-methoxy-5-nitroanilino)-1-oxopropan-2-yl] (2S,4Z)-2-tert-butyl-4-(thiophen-2-ylmethylidene)-2,3-dihydro-1H-acridine-9-carboxylate (PubChem CID 98593868) has the molecular formula C33H33N3O6S and a molecular weight of 599.71 g/mol. Its IUPAC name is [(2R)-1-(2-methoxy-5-nitroanilino)-1-oxopropan-2-yl] (2S,4Z)-2-tert-butyl-4-(thiophen-2-ylmethylidene)-2,3-dihydro-1H-acridine-9-carboxylate.
| Compound Name | [(2R)-1-(2-methoxy-5-nitroanilino)-1-oxopropan-2-yl] (2S,4Z)-2-tert-butyl-4-(thiophen-2-ylmethylidene)-2,3-dihydro-1H-acridine-9-carboxylate |
|---|---|
| PubChem CID | 98593868 |
| Molecular Formula | C33H33N3O6S |
| Molecular Weight | 599.71 g/mol |
| Exact Mass | 599.21 |
| IUPAC Name | [(2R)-1-(2-methoxy-5-nitroanilino)-1-oxopropan-2-yl] (2S,4Z)-2-tert-butyl-4-(thiophen-2-ylmethylidene)-2,3-dihydro-1H-acridine-9-carboxylate |
| SMILES | COc1ccc([N+](=O)[O-])cc1NC(=O)[C@@H](C)OC(=O)c1c2c(nc3ccccc13)/C(=C\c1cccs1)C[C@H](C(C)(C)C)C2 |
| InChI | InChI=1S/C33H33N3O6S/c1-19(31(37)35-27-18-22(36(39)40)12-13-28(27)41-5)42-32(38)29-24-10-6-7-11-26(24)34-30-20(16-23-9-8-14-43-23)15-21(17-25(29)30)33(2,3)4/h6-14,16,18-19,21H,15,17H2,1-5H3,(H,35,37)/b20-16-/t19-,21+/m1/s1 |
| InChIKey | XFUTULXEMAAZEY-GFPKEUDCSA-N |
| XLogP | 7.55 |
| TPSA | 120.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.71 |
| LogP ≤ 5 | 7.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|