About (3''R,4''R)-4-Phenyl-[1,3'']bipiperidinyl-4''-ol
(3''R,4''R)-4-Phenyl-[1,3'']bipiperidinyl-4''-ol (PubChem CID 9859994) has the molecular formula C16H24N2O
and a molecular weight of 260.37 g/mol. Its IUPAC name is (3R,4R)-3-(4-phenylpiperidin-1-yl)piperidin-4-ol.
Molecular Properties
| Compound Name | (3''R,4''R)-4-Phenyl-[1,3'']bipiperidinyl-4''-ol |
| PubChem CID | 9859994 |
| Molecular Formula | C16H24N2O |
| Molecular Weight | 260.37 g/mol |
| Exact Mass | 260.19 |
| IUPAC Name | (3R,4R)-3-(4-phenylpiperidin-1-yl)piperidin-4-ol |
| SMILES | C1CNC[C@H]([C@@H]1O)N2CCC(CC2)C3=CC=CC=C3 |
| InChI | InChI=1S/C16H24N2O/c19-16-6-9-17-12-15(16)18-10-7-14(8-11-18)13-4-2-1-3-5-13/h1-5,14-17,19H,6-12H2/t15-,16-/m1/s1 |
| InChIKey | XUPDJGDKEAPXHU-HZPDHXFCSA-N |
| XLogP | 1.60 |
| TPSA | 35.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | 270 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 260.37 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (3''R,4''R)-4-Phenyl-[1,3'']bipiperidinyl-4''-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3''R,4''R)-4-Phenyl-[1,3'']bipiperidinyl-4''-ol?
The IUPAC name of (3''R,4''R)-4-Phenyl-[1,3'']bipiperidinyl-4''-ol (CID 9859994) is (3R,4R)-3-(4-phenylpiperidin-1-yl)piperidin-4-ol.
What is the SMILES notation for (3''R,4''R)-4-Phenyl-[1,3'']bipiperidinyl-4''-ol?
The canonical SMILES for (3''R,4''R)-4-Phenyl-[1,3'']bipiperidinyl-4''-ol is C1CNC[C@H]([C@@H]1O)N2CCC(CC2)C3=CC=CC=C3.
What is the InChIKey of (3''R,4''R)-4-Phenyl-[1,3'']bipiperidinyl-4''-ol?
The InChIKey is XUPDJGDKEAPXHU-HZPDHXFCSA-N. The full InChI is InChI=1S/C16H24N2O/c19-16-6-9-17-12-15(16)18-10-7-14(8-11-18)13-4-2-1-3-5-13/h1-5,14-17,19H,6-12H2/t15-,16-/m1/s1.
What are the key properties of (3''R,4''R)-4-Phenyl-[1,3'']bipiperidinyl-4''-ol?
(3''R,4''R)-4-Phenyl-[1,3'']bipiperidinyl-4''-ol has a molecular weight of 260.37 g/mol, XLogP of 1.60, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3''R,4''R)-4-Phenyl-[1,3'']bipiperidinyl-4''-ol is sourced from PubChem (CID 9859994), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).