C24H18FNO2 — CID 98600968
(1S,5R)-3-(4-fluorophenyl)-1-methyl-6,6-diphenyl-3-azabicyclo[3.1.0]hexane-2,4-dione (PubChem CID 98600968) has the molecular formula C24H18FNO2 and a molecular weight of 371.41 g/mol. Its IUPAC name is (1S,5R)-3-(4-fluorophenyl)-1-methyl-6,6-diphenyl-3-azabicyclo[3.1.0]hexane-2,4-dione.
| Compound Name | (1S,5R)-3-(4-fluorophenyl)-1-methyl-6,6-diphenyl-3-azabicyclo[3.1.0]hexane-2,4-dione |
|---|---|
| PubChem CID | 98600968 |
| Molecular Formula | C24H18FNO2 |
| Molecular Weight | 371.41 g/mol |
| Exact Mass | 371.13 |
| IUPAC Name | (1S,5R)-3-(4-fluorophenyl)-1-methyl-6,6-diphenyl-3-azabicyclo[3.1.0]hexane-2,4-dione |
| SMILES | C[C@]12C(=O)N(c3ccc(F)cc3)C(=O)[C@@H]1C2(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C24H18FNO2/c1-23-20(21(27)26(22(23)28)19-14-12-18(25)13-15-19)24(23,16-8-4-2-5-9-16)17-10-6-3-7-11-17/h2-15,20H,1H3/t20-,23+/m0/s1 |
| InChIKey | DSNOHHCJZFSHSZ-NZQKXSOJSA-N |
| XLogP | 4.32 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.41 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|