C22H26N2O3S — CID 98606587
N-[4-[[(1S)-1-[(1S,2R,4S)-2-bicyclo[2.2.1]heptanyl]ethyl]sulfamoyl]phenyl]benzamide (PubChem CID 98606587) has the molecular formula C22H26N2O3S and a molecular weight of 398.53 g/mol. Its IUPAC name is N-[4-[[(1S)-1-[(1S,2R,4S)-2-bicyclo[2.2.1]heptanyl]ethyl]sulfamoyl]phenyl]benzamide.
| Compound Name | N-[4-[[(1S)-1-[(1S,2R,4S)-2-bicyclo[2.2.1]heptanyl]ethyl]sulfamoyl]phenyl]benzamide |
|---|---|
| PubChem CID | 98606587 |
| Molecular Formula | C22H26N2O3S |
| Molecular Weight | 398.53 g/mol |
| Exact Mass | 398.17 |
| IUPAC Name | N-[4-[[(1S)-1-[(1S,2R,4S)-2-bicyclo[2.2.1]heptanyl]ethyl]sulfamoyl]phenyl]benzamide |
| SMILES | C[C@H](NS(=O)(=O)c1ccc(NC(=O)c2ccccc2)cc1)[C@@H]1C[C@H]2CC[C@H]1C2 |
| InChI | InChI=1S/C22H26N2O3S/c1-15(21-14-16-7-8-18(21)13-16)24-28(26,27)20-11-9-19(10-12-20)23-22(25)17-5-3-2-4-6-17/h2-6,9-12,15-16,18,21,24H,7-8,13-14H2,1H3,(H,23,25)/t15-,16-,18-,21-/m0/s1 |
| InChIKey | IQLOGDPAOUVLFL-STHPQGGCSA-N |
| XLogP | 4.04 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.53 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |