C25H22ClN3O3S — CID 98611582
(1R,9S,13R)-10-(3-chlorophenyl)-N-(4-methoxyphenyl)-9-methyl-11-sulfanylidene-8-oxa-10,12-diazatricyclo[7.3.1.02,7]trideca-2,4,6-triene-13-carboxamide (PubChem CID 98611582) has the molecular formula C25H22ClN3O3S and a molecular weight of 479.99 g/mol. Its IUPAC name is (1R,9S,13R)-10-(3-chlorophenyl)-N-(4-methoxyphenyl)-9-methyl-11-sulfanylidene-8-oxa-10,12-diazatricyclo[7.3.1.02,7]trideca-2,4,6-triene-13-carboxamide.
| Compound Name | (1R,9S,13R)-10-(3-chlorophenyl)-N-(4-methoxyphenyl)-9-methyl-11-sulfanylidene-8-oxa-10,12-diazatricyclo[7.3.1.02,7]trideca-2,4,6-triene-13-carboxamide |
|---|---|
| PubChem CID | 98611582 |
| Molecular Formula | C25H22ClN3O3S |
| Molecular Weight | 479.99 g/mol |
| Exact Mass | 479.11 |
| IUPAC Name | (1R,9S,13R)-10-(3-chlorophenyl)-N-(4-methoxyphenyl)-9-methyl-11-sulfanylidene-8-oxa-10,12-diazatricyclo[7.3.1.02,7]trideca-2,4,6-triene-13-carboxamide |
| SMILES | COc1ccc(NC(=O)[C@@H]2[C@H]3NC(=S)N(c4cccc(Cl)c4)[C@@]2(C)Oc2ccccc23)cc1 |
| InChI | InChI=1S/C25H22ClN3O3S/c1-25-21(23(30)27-16-10-12-18(31-2)13-11-16)22(19-8-3-4-9-20(19)32-25)28-24(33)29(25)17-7-5-6-15(26)14-17/h3-14,21-22H,1-2H3,(H,27,30)(H,28,33)/t21-,22-,25-/m0/s1 |
| InChIKey | XVJVMOQETDEOBP-HWBMXIPRSA-N |
| XLogP | 5.15 |
| TPSA | 62.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.99 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|