C22H21ClN2O4S — CID 98611859
prop-2-enyl (1R,9S,13R)-10-(4-chlorophenyl)-6-methoxy-9-methyl-11-sulfanylidene-8-oxa-10,12-diazatricyclo[7.3.1.02,7]trideca-2(7),3,5-triene-13-carboxylate (PubChem CID 98611859) has the molecular formula C22H21ClN2O4S and a molecular weight of 444.94 g/mol. Its IUPAC name is prop-2-enyl (1R,9S,13R)-10-(4-chlorophenyl)-6-methoxy-9-methyl-11-sulfanylidene-8-oxa-10,12-diazatricyclo[7.3.1.02,7]trideca-2(7),3,5-triene-13-carboxylate.
| Compound Name | prop-2-enyl (1R,9S,13R)-10-(4-chlorophenyl)-6-methoxy-9-methyl-11-sulfanylidene-8-oxa-10,12-diazatricyclo[7.3.1.02,7]trideca-2(7),3,5-triene-13-carboxylate |
|---|---|
| PubChem CID | 98611859 |
| Molecular Formula | C22H21ClN2O4S |
| Molecular Weight | 444.94 g/mol |
| Exact Mass | 444.09 |
| IUPAC Name | prop-2-enyl (1R,9S,13R)-10-(4-chlorophenyl)-6-methoxy-9-methyl-11-sulfanylidene-8-oxa-10,12-diazatricyclo[7.3.1.02,7]trideca-2(7),3,5-triene-13-carboxylate |
| SMILES | C=CCOC(=O)[C@@H]1[C@H]2NC(=S)N(c3ccc(Cl)cc3)[C@@]1(C)Oc1c(OC)cccc12 |
| InChI | InChI=1S/C22H21ClN2O4S/c1-4-12-28-20(26)17-18-15-6-5-7-16(27-3)19(15)29-22(17,2)25(21(30)24-18)14-10-8-13(23)9-11-14/h4-11,17-18H,1,12H2,2-3H3,(H,24,30)/t17-,18-,22-/m0/s1 |
| InChIKey | SACUKKGZXJUUEC-SPEDKVCISA-N |
| XLogP | 4.24 |
| TPSA | 60.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.94 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|