C19H26N2O3 — CID 98613004
3-[(1R,2R,6R,7R)-3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl]-N-(4-methylcyclohexyl)propanamide (PubChem CID 98613004) has the molecular formula C19H26N2O3 and a molecular weight of 330.43 g/mol. Its IUPAC name is 3-[(1R,2R,6R,7R)-3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl]-N-(4-methylcyclohexyl)propanamide.
| Compound Name | 3-[(1R,2R,6R,7R)-3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl]-N-(4-methylcyclohexyl)propanamide |
|---|---|
| PubChem CID | 98613004 |
| Molecular Formula | C19H26N2O3 |
| Molecular Weight | 330.43 g/mol |
| Exact Mass | 330.19 |
| IUPAC Name | 3-[(1R,2R,6R,7R)-3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl]-N-(4-methylcyclohexyl)propanamide |
| SMILES | CC1CCC(NC(=O)CCN2C(=O)[C@H]3[C@H](C2=O)[C@H]2C=C[C@H]3C2)CC1 |
| InChI | InChI=1S/C19H26N2O3/c1-11-2-6-14(7-3-11)20-15(22)8-9-21-18(23)16-12-4-5-13(10-12)17(16)19(21)24/h4-5,11-14,16-17H,2-3,6-10H2,1H3,(H,20,22)/t11?,12-,13-,14?,16+,17+/m0/s1 |
| InChIKey | CERGAIYXOYAOSI-OWJIKZNTSA-N |
| XLogP | 1.88 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.43 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|