C13H12Cl6O — CID 98615662
5-[(1S,2R,4S)-1,4,5,6,7,7-hexachloro-2-bicyclo[2.2.1]hept-5-enyl]-2-methylpent-3-yn-2-ol (PubChem CID 98615662) has the molecular formula C13H12Cl6O and a molecular weight of 396.96 g/mol. Its IUPAC name is 5-[(1S,2R,4S)-1,4,5,6,7,7-hexachloro-2-bicyclo[2.2.1]hept-5-enyl]-2-methylpent-3-yn-2-ol.
| Compound Name | 5-[(1S,2R,4S)-1,4,5,6,7,7-hexachloro-2-bicyclo[2.2.1]hept-5-enyl]-2-methylpent-3-yn-2-ol |
|---|---|
| PubChem CID | 98615662 |
| Molecular Formula | C13H12Cl6O |
| Molecular Weight | 396.96 g/mol |
| Exact Mass | 393.90 |
| IUPAC Name | 5-[(1S,2R,4S)-1,4,5,6,7,7-hexachloro-2-bicyclo[2.2.1]hept-5-enyl]-2-methylpent-3-yn-2-ol |
| SMILES | CC(C)(O)C#CC[C@@H]1C[C@]2(Cl)C(Cl)=C(Cl)[C@]1(Cl)C2(Cl)Cl |
| InChI | InChI=1S/C13H12Cl6O/c1-10(2,20)5-3-4-7-6-11(16)8(14)9(15)12(7,17)13(11,18)19/h7,20H,4,6H2,1-2H3/t7-,11+,12+/m1/s1 |
| InChIKey | FSEWYBKECRKVOT-MKCWBWRRSA-N |
| XLogP | 5.00 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.96 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|