C18H27N7 — CID 98616956
6-N-[[7-(cyclopropylmethyl)-5,6,8,9-tetrahydroimidazo[1,2-d][1,4]diazepin-3-yl]methyl]-4-N,4-N-dimethylpyrimidine-4,6-diamine (PubChem CID 98616956) has the molecular formula C18H27N7 and a molecular weight of 341.46 g/mol. Its IUPAC name is 6-N-[[7-(cyclopropylmethyl)-5,6,8,9-tetrahydroimidazo[1,2-d][1,4]diazepin-3-yl]methyl]-4-N,4-N-dimethylpyrimidine-4,6-diamine.
| Compound Name | 6-N-[[7-(cyclopropylmethyl)-5,6,8,9-tetrahydroimidazo[1,2-d][1,4]diazepin-3-yl]methyl]-4-N,4-N-dimethylpyrimidine-4,6-diamine |
|---|---|
| PubChem CID | 98616956 |
| Molecular Formula | C18H27N7 |
| Molecular Weight | 341.46 g/mol |
| Exact Mass | 341.23 |
| IUPAC Name | 6-N-[[7-(cyclopropylmethyl)-5,6,8,9-tetrahydroimidazo[1,2-d][1,4]diazepin-3-yl]methyl]-4-N,4-N-dimethylpyrimidine-4,6-diamine |
| SMILES | CN(C)c1cc(NCc2cnc3n2CCN(CC2CC2)CC3)ncn1 |
| InChI | InChI=1S/C18H27N7/c1-23(2)18-9-16(21-13-22-18)19-10-15-11-20-17-5-6-24(7-8-25(15)17)12-14-3-4-14/h9,11,13-14H,3-8,10,12H2,1-2H3,(H,19,21,22) |
| InChIKey | QWIZXCYZCVSIGZ-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 62.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.46 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |