About (S)-(4,6-dichloropyrimidin-5-yl)-phenylmethanol
(S)-(4,6-dichloropyrimidin-5-yl)-phenylmethanol (PubChem CID 98619139) has the molecular formula C11H8Cl2N2O
and a molecular weight of 255.10 g/mol. Its IUPAC name is (S)-(4,6-dichloropyrimidin-5-yl)-phenylmethanol.
Molecular Properties
| Compound Name | (S)-(4,6-dichloropyrimidin-5-yl)-phenylmethanol |
| PubChem CID | 98619139 |
| Molecular Formula | C11H8Cl2N2O |
| Molecular Weight | 255.10 g/mol |
| Exact Mass | 254.00 |
| IUPAC Name | (S)-(4,6-dichloropyrimidin-5-yl)-phenylmethanol |
| SMILES | O[C@@H](c1ccccc1)c1c(Cl)ncnc1Cl |
| InChI | InChI=1S/C11H8Cl2N2O/c12-10-8(11(13)15-6-14-10)9(16)7-4-2-1-3-5-7/h1-6,9,16H/t9-/m0/s1 |
| InChIKey | JUVWZXZUBKJFSQ-VIFPVBQESA-N |
| XLogP | 2.87 |
| TPSA | 46.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 255.10 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (S)-(4,6-dichloropyrimidin-5-yl)-phenylmethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (S)-(4,6-dichloropyrimidin-5-yl)-phenylmethanol?
The IUPAC name of (S)-(4,6-dichloropyrimidin-5-yl)-phenylmethanol (CID 98619139) is (S)-(4,6-dichloropyrimidin-5-yl)-phenylmethanol.
What is the SMILES notation for (S)-(4,6-dichloropyrimidin-5-yl)-phenylmethanol?
The canonical SMILES for (S)-(4,6-dichloropyrimidin-5-yl)-phenylmethanol is O[C@@H](c1ccccc1)c1c(Cl)ncnc1Cl.
What is the InChIKey of (S)-(4,6-dichloropyrimidin-5-yl)-phenylmethanol?
The InChIKey is JUVWZXZUBKJFSQ-VIFPVBQESA-N. The full InChI is InChI=1S/C11H8Cl2N2O/c12-10-8(11(13)15-6-14-10)9(16)7-4-2-1-3-5-7/h1-6,9,16H/t9-/m0/s1.
What are the key properties of (S)-(4,6-dichloropyrimidin-5-yl)-phenylmethanol?
(S)-(4,6-dichloropyrimidin-5-yl)-phenylmethanol has a molecular weight of 255.10 g/mol, XLogP of 2.87, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (S)-(4,6-dichloropyrimidin-5-yl)-phenylmethanol is sourced from PubChem (CID 98619139), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).